About 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine
6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine (PubChem CID 174268156) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine.
Molecular Properties
| Compound Name | 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine |
| PubChem CID | 174268156 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine |
| SMILES | CCCC(C)(CCC)C1=CN=CC(C)C=N1 |
| InChI | InChI=1S/C14H24N2/c1-5-7-14(4,8-6-2)13-11-15-9-12(3)10-16-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | ORDFBFBVVONXLU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine?
The IUPAC name of 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine (CID 174268156) is 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine.
What is the SMILES notation for 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine?
The canonical SMILES for 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine is CCCC(C)(CCC)C1=CN=CC(C)C=N1.
What is the InChIKey of 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine?
The InChIKey is ORDFBFBVVONXLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-5-7-14(4,8-6-2)13-11-15-9-12(3)10-16-13/h9-12H,5-8H2,1-4H3.
What are the key properties of 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine?
6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine has a molecular weight of 220.36 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(4-methylheptan-4-yl)-6H-1,4-diazepine is sourced from PubChem (CID 174268156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).