About 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride
1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride (PubChem CID 174268218) has the molecular formula C6H8ClF3N2O3S
and a molecular weight of 280.66 g/mol. Its IUPAC name is 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride.
Molecular Properties
| Compound Name | 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride |
| PubChem CID | 174268218 |
| Molecular Formula | C6H8ClF3N2O3S |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride |
| SMILES | Cc1c(S(=O)(=O)O)c(C(F)(F)F)nn1C.Cl |
| InChI | InChI=1S/C6H7F3N2O3S.ClH/c1-3-4(15(12,13)14)5(6(7,8)9)10-11(3)2;/h1-2H3,(H,12,13,14);1H |
| InChIKey | XCYTYBBTRWPBNA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride?
The IUPAC name of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride (CID 174268218) is 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride.
What is the SMILES notation for 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride?
The canonical SMILES for 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride is Cc1c(S(=O)(=O)O)c(C(F)(F)F)nn1C.Cl.
What is the InChIKey of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride?
The InChIKey is XCYTYBBTRWPBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N2O3S.ClH/c1-3-4(15(12,13)14)5(6(7,8)9)10-11(3)2;/h1-2H3,(H,12,13,14);1H.
What are the key properties of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride?
1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride has a molecular weight of 280.66 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonic acid;hydrochloride is sourced from PubChem (CID 174268218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).