C11H6N2O3 — CID 174269134
5-imidazol-1-yl-2-benzofuran-1,3-dione (PubChem CID 174269134) has the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. Its IUPAC name is 5-imidazol-1-yl-2-benzofuran-1,3-dione.
| Compound Name | 5-imidazol-1-yl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 174269134 |
| Molecular Formula | C11H6N2O3 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-imidazol-1-yl-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-n3ccnc3)ccc21 |
| InChI | InChI=1S/C11H6N2O3/c14-10-8-2-1-7(13-4-3-12-6-13)5-9(8)11(15)16-10/h1-6H |
| InChIKey | YITSSWCZDRLXCI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|