About 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol
2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol (PubChem CID 174269757) has the molecular formula C16H14F3NOS
and a molecular weight of 325.36 g/mol. Its IUPAC name is 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol.
Molecular Properties
| Compound Name | 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol |
| PubChem CID | 174269757 |
| Molecular Formula | C16H14F3NOS |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol |
| SMILES | OC1CN(C(F)(F)F)C(c2ccccc2)(c2ccccc2)S1 |
| InChI | InChI=1S/C16H14F3NOS/c17-16(18,19)20-11-14(21)22-15(20,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14,21H,11H2 |
| InChIKey | BOYLAFUTTRFGPE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol?
The IUPAC name of 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol (CID 174269757) is 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol.
What is the SMILES notation for 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol?
The canonical SMILES for 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol is OC1CN(C(F)(F)F)C(c2ccccc2)(c2ccccc2)S1.
What is the InChIKey of 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol?
The InChIKey is BOYLAFUTTRFGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NOS/c17-16(18,19)20-11-14(21)22-15(20,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14,21H,11H2.
What are the key properties of 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol?
2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol has a molecular weight of 325.36 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol is sourced from PubChem (CID 174269757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).