C20H23BrN2O4 — CID 17426993
2-(2-bromo-4,5-dimethoxyphenyl)-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 17426993) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17426993 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1cc(Br)c(CC(=O)Nc2ccccc2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C20H23BrN2O4/c1-25-18-11-14(15(21)13-19(18)26-2)12-20(24)22-16-5-3-4-6-17(16)23-7-9-27-10-8-23/h3-6,11,13H,7-10,12H2,1-2H3,(H,22,24) |
| InChIKey | XTPGBGZJDWFJCE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |