C25H22ClF3O3 — CID 174270512
7-chloro-3,4,5,6-tetrahydrochrysene;3-methylfuran;2,2,2-trifluoroacetic acid (PubChem CID 174270512) has the molecular formula C25H22ClF3O3 and a molecular weight of 462.90 g/mol. Its IUPAC name is 7-chloro-3,4,5,6-tetrahydrochrysene;3-methylfuran;2,2,2-trifluoroacetic acid.
| Compound Name | 7-chloro-3,4,5,6-tetrahydrochrysene;3-methylfuran;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174270512 |
| Molecular Formula | C25H22ClF3O3 |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 7-chloro-3,4,5,6-tetrahydrochrysene;3-methylfuran;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccoc1.Clc1cccc2c1CCc1c-2ccc2c1CCC=C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H15Cl.C5H6O.C2HF3O2/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-5-2-3-6-4-5;3-2(4,5)1(6)7/h1,3-4,6-9H,2,5,10-11H2;2-4H,1H3;(H,6,7) |
| InChIKey | FFGKVXNQFDBYCC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |