About (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine
(E)-4-methoxy-N,2-dimethylbut-1-en-1-amine (PubChem CID 174271383) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine |
| PubChem CID | 174271383 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine |
| SMILES | CN/C=C(\C)CCOC |
| InChI | InChI=1S/C7H15NO/c1-7(6-8-2)4-5-9-3/h6,8H,4-5H2,1-3H3/b7-6+ |
| InChIKey | PQRDNJRXYYLPLF-VOTSOKGWSA-N |
| XLogP | 1.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine?
The IUPAC name of (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine (CID 174271383) is (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine.
What is the SMILES notation for (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine?
The canonical SMILES for (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine is CN/C=C(\C)CCOC.
What is the InChIKey of (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine?
The InChIKey is PQRDNJRXYYLPLF-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H15NO/c1-7(6-8-2)4-5-9-3/h6,8H,4-5H2,1-3H3/b7-6+.
What are the key properties of (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine?
(E)-4-methoxy-N,2-dimethylbut-1-en-1-amine has a molecular weight of 129.20 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-methoxy-N,2-dimethylbut-1-en-1-amine is sourced from PubChem (CID 174271383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).