C20H32FN — CID 174271500
N-[1-(1-fluorocyclooct-2-yn-1-yl)ethenyl]-2,4,4,5-tetramethylhex-5-en-2-amine (PubChem CID 174271500) has the molecular formula C20H32FN and a molecular weight of 305.48 g/mol. Its IUPAC name is N-[1-(1-fluorocyclooct-2-yn-1-yl)ethenyl]-2,4,4,5-tetramethylhex-5-en-2-amine.
| Compound Name | N-[1-(1-fluorocyclooct-2-yn-1-yl)ethenyl]-2,4,4,5-tetramethylhex-5-en-2-amine |
|---|---|
| PubChem CID | 174271500 |
| Molecular Formula | C20H32FN |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | N-[1-(1-fluorocyclooct-2-yn-1-yl)ethenyl]-2,4,4,5-tetramethylhex-5-en-2-amine |
| SMILES | C=C(C)C(C)(C)CC(C)(C)NC(=C)C1(F)C#CCCCCC1 |
| InChI | InChI=1S/C20H32FN/c1-16(2)18(4,5)15-19(6,7)22-17(3)20(21)13-11-9-8-10-12-14-20/h22H,1,3,8-11,13,15H2,2,4-7H3 |
| InChIKey | FFLGETGGXOFWTJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|