About cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine
cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine (PubChem CID 174272062) has the molecular formula C10H27N3O2Si
and a molecular weight of 249.43 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine |
| PubChem CID | 174272062 |
| Molecular Formula | C10H27N3O2Si |
| Molecular Weight | 249.43 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine |
| SMILES | CN.CN.CN.CO[SiH](OC)C1C=CC=C1 |
| InChI | InChI=1S/C7H12O2Si.3CH5N/c1-8-10(9-2)7-5-3-4-6-7;3*1-2/h3-7,10H,1-2H3;3*2H2,1H3 |
| InChIKey | MBUBMMOETLBHCM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.43 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine?
The IUPAC name of cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine (CID 174272062) is cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine.
What is the SMILES notation for cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine?
The canonical SMILES for cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine is CN.CN.CN.CO[SiH](OC)C1C=CC=C1.
What is the InChIKey of cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine?
The InChIKey is MBUBMMOETLBHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2Si.3CH5N/c1-8-10(9-2)7-5-3-4-6-7;3*1-2/h3-7,10H,1-2H3;3*2H2,1H3.
What are the key properties of cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine?
cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine has a molecular weight of 249.43 g/mol, XLogP of -0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-yl(dimethoxy)silane;methanamine is sourced from PubChem (CID 174272062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).