C28H39N3O4 — CID 174272207
3-(isoquinolin-6-ylmethyl)-11-methoxy-7,15-dimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione (PubChem CID 174272207) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is 3-(isoquinolin-6-ylmethyl)-11-methoxy-7,15-dimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione.
| Compound Name | 3-(isoquinolin-6-ylmethyl)-11-methoxy-7,15-dimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
|---|---|
| PubChem CID | 174272207 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 3-(isoquinolin-6-ylmethyl)-11-methoxy-7,15-dimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
| SMILES | COC1CCCN(C)C2(CCN(Cc3ccc4cnccc4c3)CC2)COC(=O)C(C)C(=O)CC1 |
| InChI | InChI=1S/C28H39N3O4/c1-21-26(32)9-8-25(34-3)5-4-14-30(2)28(20-35-27(21)33)11-15-31(16-12-28)19-22-6-7-24-18-29-13-10-23(24)17-22/h6-7,10,13,17-18,21,25H,4-5,8-9,11-12,14-16,19-20H2,1-3H3 |
| InChIKey | GWBQCCBTSZLCFI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|