About 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole
5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole (PubChem CID 174272288) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole |
| PubChem CID | 174272288 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole |
| SMILES | CCc1cn[nH]c1CC(OC)OC |
| InChI | InChI=1S/C9H16N2O2/c1-4-7-6-10-11-8(7)5-9(12-2)13-3/h6,9H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | OLFZHPKDZOBCBG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole?
The IUPAC name of 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole (CID 174272288) is 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole.
What is the SMILES notation for 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole?
The canonical SMILES for 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole is CCc1cn[nH]c1CC(OC)OC.
What is the InChIKey of 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole?
The InChIKey is OLFZHPKDZOBCBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-4-7-6-10-11-8(7)5-9(12-2)13-3/h6,9H,4-5H2,1-3H3,(H,10,11).
What are the key properties of 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole?
5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole has a molecular weight of 184.24 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethoxyethyl)-4-ethyl-1H-pyrazole is sourced from PubChem (CID 174272288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).