About 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one
4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one (PubChem CID 174272394) has the molecular formula C8H6ClN3O
and a molecular weight of 195.61 g/mol. Its IUPAC name is 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one |
| PubChem CID | 174272394 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one |
| SMILES | Cc1nc(Cl)c2[nH]ccc(=O)c2n1 |
| InChI | InChI=1S/C8H6ClN3O/c1-4-11-6-5(13)2-3-10-7(6)8(9)12-4/h2-3H,1H3,(H,10,13) |
| InChIKey | BXPDHQIBVOYAHA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one?
The IUPAC name of 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one (CID 174272394) is 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one.
What is the SMILES notation for 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one?
The canonical SMILES for 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one is Cc1nc(Cl)c2[nH]ccc(=O)c2n1.
What is the InChIKey of 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one?
The InChIKey is BXPDHQIBVOYAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O/c1-4-11-6-5(13)2-3-10-7(6)8(9)12-4/h2-3H,1H3,(H,10,13).
What are the key properties of 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one?
4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one has a molecular weight of 195.61 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-5H-pyrido[3,2-d]pyrimidin-8-one is sourced from PubChem (CID 174272394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).