C26H38N2O5 — CID 174272557
3-benzoyl-11-methoxy-7,9,15-trimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione (PubChem CID 174272557) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-benzoyl-11-methoxy-7,9,15-trimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione.
| Compound Name | 3-benzoyl-11-methoxy-7,9,15-trimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
|---|---|
| PubChem CID | 174272557 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 3-benzoyl-11-methoxy-7,9,15-trimethyl-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
| SMILES | COC1CCC(=O)C(C)C(=O)OCC2(CCN(C(=O)c3ccccc3)CC2)N(C)CC(C)C1 |
| InChI | InChI=1S/C26H38N2O5/c1-19-16-22(32-4)10-11-23(29)20(2)25(31)33-18-26(27(3)17-19)12-14-28(15-13-26)24(30)21-8-6-5-7-9-21/h5-9,19-20,22H,10-18H2,1-4H3 |
| InChIKey | IHMOKVSUCRUJKN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|