C16H20S — CID 174272739
3-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,8a,9,9a-hexahydrobenzo[f][1]benzothiole (PubChem CID 174272739) has the molecular formula C16H20S and a molecular weight of 244.40 g/mol. Its IUPAC name is 3-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,8a,9,9a-hexahydrobenzo[f][1]benzothiole.
| Compound Name | 3-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,8a,9,9a-hexahydrobenzo[f][1]benzothiole |
|---|---|
| PubChem CID | 174272739 |
| Molecular Formula | C16H20S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,8a,9,9a-hexahydrobenzo[f][1]benzothiole |
| SMILES | C/C=C\C1SC2CC3C=CC=CC3=CC2C1C |
| InChI | InChI=1S/C16H20S/c1-3-6-15-11(2)14-9-12-7-4-5-8-13(12)10-16(14)17-15/h3-9,11,13-16H,10H2,1-2H3/b6-3- |
| InChIKey | ANBWFFXEOVZWJI-UTCJRWHESA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|