C13H24NO4P — CID 174273004
1,1-diethoxy-1-phosphoroso-3-piperidin-2-ylbutan-2-one (PubChem CID 174273004) has the molecular formula C13H24NO4P and a molecular weight of 289.31 g/mol. Its IUPAC name is 1,1-diethoxy-1-phosphoroso-3-piperidin-2-ylbutan-2-one.
| Compound Name | 1,1-diethoxy-1-phosphoroso-3-piperidin-2-ylbutan-2-one |
|---|---|
| PubChem CID | 174273004 |
| Molecular Formula | C13H24NO4P |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1,1-diethoxy-1-phosphoroso-3-piperidin-2-ylbutan-2-one |
| SMILES | CCOC(OCC)(P=O)C(=O)C(C)C1CCCCN1 |
| InChI | InChI=1S/C13H24NO4P/c1-4-17-13(19-16,18-5-2)12(15)10(3)11-8-6-7-9-14-11/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | DPZFJNXYFODBDB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|