About 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile
6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile (PubChem CID 174274469) has the molecular formula C13H15F2N3
and a molecular weight of 251.28 g/mol. Its IUPAC name is 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile |
| PubChem CID | 174274469 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCC2CCC(F)(F)CC2)nc1 |
| InChI | InChI=1S/C13H15F2N3/c14-13(15)5-3-10(4-6-13)8-17-12-2-1-11(7-16)9-18-12/h1-2,9-10H,3-6,8H2,(H,17,18) |
| InChIKey | QONRBUDSJLNMKA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile?
The IUPAC name of 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile (CID 174274469) is 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile is N#Cc1ccc(NCC2CCC(F)(F)CC2)nc1.
What is the InChIKey of 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile?
The InChIKey is QONRBUDSJLNMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3/c14-13(15)5-3-10(4-6-13)8-17-12-2-1-11(7-16)9-18-12/h1-2,9-10H,3-6,8H2,(H,17,18).
What are the key properties of 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile?
6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile has a molecular weight of 251.28 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4,4-difluorocyclohexyl)methylamino]pyridine-3-carbonitrile is sourced from PubChem (CID 174274469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).