About 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine
1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine (PubChem CID 174274739) has the molecular formula C14H13F3N4O5S
and a molecular weight of 406.34 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine |
| PubChem CID | 174274739 |
| Molecular Formula | C14H13F3N4O5S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine |
| SMILES | COc1cc(NC(=O)N=S(=O)=O)nc(OC)c1.FC(F)(F)c1cccnc1 |
| InChI | InChI=1S/C8H9N3O5S.C6H4F3N/c1-15-5-3-6(9-7(4-5)16-2)10-8(12)11-17(13)14;7-6(8,9)5-2-1-3-10-4-5/h3-4H,1-2H3,(H,9,10,12);1-4H |
| InChIKey | BUZHYKJOEMERHT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine?
The IUPAC name of 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine (CID 174274739) is 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine.
What is the SMILES notation for 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine?
The canonical SMILES for 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine is COc1cc(NC(=O)N=S(=O)=O)nc(OC)c1.FC(F)(F)c1cccnc1.
What is the InChIKey of 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine?
The InChIKey is BUZHYKJOEMERHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O5S.C6H4F3N/c1-15-5-3-6(9-7(4-5)16-2)10-8(12)11-17(13)14;7-6(8,9)5-2-1-3-10-4-5/h3-4H,1-2H3,(H,9,10,12);1-4H.
What are the key properties of 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine?
1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine has a molecular weight of 406.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxy-2-pyridinyl)-3-sulfonylurea;3-(trifluoromethyl)pyridine is sourced from PubChem (CID 174274739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).