About 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine
3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine (PubChem CID 174274740) has the molecular formula C13H30N2O3Si
and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine |
| PubChem CID | 174274740 |
| Molecular Formula | C13H30N2O3Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine |
| SMILES | COC1(CCCN)C(CCN)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C13H30N2O3Si/c1-16-13(8-5-9-14)12(7-10-15)6-4-11-19(13,17-2)18-3/h12H,4-11,14-15H2,1-3H3 |
| InChIKey | WULORQMEMMESCZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine?
The IUPAC name of 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine (CID 174274740) is 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine.
What is the SMILES notation for 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine?
The canonical SMILES for 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine is COC1(CCCN)C(CCN)CCC[Si]1(OC)OC.
What is the InChIKey of 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine?
The InChIKey is WULORQMEMMESCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O3Si/c1-16-13(8-5-9-14)12(7-10-15)6-4-11-19(13,17-2)18-3/h12H,4-11,14-15H2,1-3H3.
What are the key properties of 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine?
3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine has a molecular weight of 290.48 g/mol, XLogP of 1.14, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminoethyl)-1,1,2-trimethoxysilinan-2-yl]propan-1-amine is sourced from PubChem (CID 174274740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).