About benzene;4-methylquinazoline
benzene;4-methylquinazoline (PubChem CID 174274782) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is benzene;4-methylquinazoline.
Molecular Properties
| Compound Name | benzene;4-methylquinazoline |
| PubChem CID | 174274782 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | benzene;4-methylquinazoline |
| SMILES | Cc1ncnc2ccccc12.c1ccccc1 |
| InChI | InChI=1S/C9H8N2.C6H6/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2-4-6-5-3-1/h2-6H,1H3;1-6H |
| InChIKey | BJXNTGFDRBLZAF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;4-methylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-methylquinazoline?
The IUPAC name of benzene;4-methylquinazoline (CID 174274782) is benzene;4-methylquinazoline.
What is the SMILES notation for benzene;4-methylquinazoline?
The canonical SMILES for benzene;4-methylquinazoline is Cc1ncnc2ccccc12.c1ccccc1.
What is the InChIKey of benzene;4-methylquinazoline?
The InChIKey is BJXNTGFDRBLZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C6H6/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2-4-6-5-3-1/h2-6H,1H3;1-6H.
What are the key properties of benzene;4-methylquinazoline?
benzene;4-methylquinazoline has a molecular weight of 222.29 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-methylquinazoline is sourced from PubChem (CID 174274782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).