C24H48N4 — CID 174276314
(2S)-4-[[1-(1-heptan-2-ylpiperidin-4-yl)piperidin-4-yl]methyl]-1,2-dimethylpiperazine (PubChem CID 174276314) has the molecular formula C24H48N4 and a molecular weight of 392.68 g/mol. Its IUPAC name is (2S)-4-[[1-(1-heptan-2-ylpiperidin-4-yl)piperidin-4-yl]methyl]-1,2-dimethylpiperazine.
| Compound Name | (2S)-4-[[1-(1-heptan-2-ylpiperidin-4-yl)piperidin-4-yl]methyl]-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 174276314 |
| Molecular Formula | C24H48N4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.39 |
| IUPAC Name | (2S)-4-[[1-(1-heptan-2-ylpiperidin-4-yl)piperidin-4-yl]methyl]-1,2-dimethylpiperazine |
| SMILES | CCCCCC(C)N1CCC(N2CCC(CN3CCN(C)[C@@H](C)C3)CC2)CC1 |
| InChI | InChI=1S/C24H48N4/c1-5-6-7-8-21(2)27-15-11-24(12-16-27)28-13-9-23(10-14-28)20-26-18-17-25(4)22(3)19-26/h21-24H,5-20H2,1-4H3/t21?,22-/m0/s1 |
| InChIKey | CCVWHJZISSFGJF-KEKNWZKVSA-N |
| XLogP | 3.77 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|