About 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine
2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine (PubChem CID 174276665) has the molecular formula C18H18N2S3
and a molecular weight of 358.56 g/mol. Its IUPAC name is 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine |
| PubChem CID | 174276665 |
| Molecular Formula | C18H18N2S3 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine |
| SMILES | CCC(C)c1cc2sc(-c3nc4c(N)ccc(C)c4s3)cc2s1 |
| InChI | InChI=1S/C18H18N2S3/c1-4-9(2)12-7-13-14(21-12)8-15(22-13)18-20-16-11(19)6-5-10(3)17(16)23-18/h5-9H,4,19H2,1-3H3 |
| InChIKey | RVTXIWFINZVMJV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine?
The IUPAC name of 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine (CID 174276665) is 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine.
What is the SMILES notation for 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine?
The canonical SMILES for 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine is CCC(C)c1cc2sc(-c3nc4c(N)ccc(C)c4s3)cc2s1.
What is the InChIKey of 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine?
The InChIKey is RVTXIWFINZVMJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2S3/c1-4-9(2)12-7-13-14(21-12)8-15(22-13)18-20-16-11(19)6-5-10(3)17(16)23-18/h5-9H,4,19H2,1-3H3.
What are the key properties of 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine?
2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine has a molecular weight of 358.56 g/mol, XLogP of 6.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-butan-2-ylthieno[3,2-b]thiophen-2-yl)-7-methyl-1,3-benzothiazol-4-amine is sourced from PubChem (CID 174276665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).