C13H19N5 — CID 174277248
(2Z,4E)-2-(2-methylpropylamino)-5-(4-methyl-1,2,4-triazol-3-yl)hexa-2,4-dienenitrile (PubChem CID 174277248) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is (2Z,4E)-2-(2-methylpropylamino)-5-(4-methyl-1,2,4-triazol-3-yl)hexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-(2-methylpropylamino)-5-(4-methyl-1,2,4-triazol-3-yl)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 174277248 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (2Z,4E)-2-(2-methylpropylamino)-5-(4-methyl-1,2,4-triazol-3-yl)hexa-2,4-dienenitrile |
| SMILES | C/C(=C\C=C(\C#N)NCC(C)C)c1nncn1C |
| InChI | InChI=1S/C13H19N5/c1-10(2)8-15-12(7-14)6-5-11(3)13-17-16-9-18(13)4/h5-6,9-10,15H,8H2,1-4H3/b11-5+,12-6- |
| InChIKey | VWRBFBVZAOKCFJ-MCSXFCTQSA-N |
| XLogP | 1.87 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|