C15H14BrNO3 — CID 174277389
3-[(6-bromo-3-oxo-1,2-dihydroinden-2-yl)methyl]piperidine-2,6-dione (PubChem CID 174277389) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 3-[(6-bromo-3-oxo-1,2-dihydroinden-2-yl)methyl]piperidine-2,6-dione.
| Compound Name | 3-[(6-bromo-3-oxo-1,2-dihydroinden-2-yl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174277389 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-[(6-bromo-3-oxo-1,2-dihydroinden-2-yl)methyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CC2Cc3cc(Br)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H14BrNO3/c16-11-2-3-12-9(7-11)6-10(14(12)19)5-8-1-4-13(18)17-15(8)20/h2-3,7-8,10H,1,4-6H2,(H,17,18,20) |
| InChIKey | OOKSJXRQXPVTPC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|