C26H35Cl2FN4O2Si2 — CID 174277449
2-[[2-chloro-3-[7-chloro-4-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 174277449) has the molecular formula C26H35Cl2FN4O2Si2 and a molecular weight of 581.67 g/mol. Its IUPAC name is 2-[[2-chloro-3-[7-chloro-4-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-chloro-3-[7-chloro-4-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174277449 |
| Molecular Formula | C26H35Cl2FN4O2Si2 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 2-[[2-chloro-3-[7-chloro-4-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(F)c(-c3c(Cl)n(COCC[Si](C)(C)C)c4ncccc34)nc(Cl)c21 |
| InChI | InChI=1S/C26H35Cl2FN4O2Si2/c1-36(2,3)14-12-34-16-32-11-9-19-21(29)22(31-24(27)23(19)32)20-18-8-7-10-30-26(18)33(25(20)28)17-35-13-15-37(4,5)6/h7-11H,12-17H2,1-6H3 |
| InChIKey | SJHNDIIVGWOJBG-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|