About 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol
3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol (PubChem CID 174277785) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol.
Molecular Properties
| Compound Name | 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol |
| PubChem CID | 174277785 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol |
| SMILES | CNC(C)(O)CC(NC)(NC)c1cc(O)ccc1C |
| InChI | InChI=1S/C14H25N3O2/c1-10-6-7-11(18)8-12(10)14(16-4,17-5)9-13(2,19)15-3/h6-8,15-19H,9H2,1-5H3 |
| InChIKey | VHVMUPHLZMTXHG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol?
The IUPAC name of 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol (CID 174277785) is 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol.
What is the SMILES notation for 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol?
The canonical SMILES for 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol is CNC(C)(O)CC(NC)(NC)c1cc(O)ccc1C.
What is the InChIKey of 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol?
The InChIKey is VHVMUPHLZMTXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-10-6-7-11(18)8-12(10)14(16-4,17-5)9-13(2,19)15-3/h6-8,15-19H,9H2,1-5H3.
What are the key properties of 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol?
3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol has a molecular weight of 267.37 g/mol, XLogP of 0.61, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-hydroxy-1,1,3-tris(methylamino)butyl]-4-methylphenol is sourced from PubChem (CID 174277785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).