C17H14BrN3O2 — CID 174278444
N-[2-(2-bromophenyl)-3H-benzimidazol-5-yl]-2-methoxyprop-2-enamide (PubChem CID 174278444) has the molecular formula C17H14BrN3O2 and a molecular weight of 372.22 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)-3H-benzimidazol-5-yl]-2-methoxyprop-2-enamide.
| Compound Name | N-[2-(2-bromophenyl)-3H-benzimidazol-5-yl]-2-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 174278444 |
| Molecular Formula | C17H14BrN3O2 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[2-(2-bromophenyl)-3H-benzimidazol-5-yl]-2-methoxyprop-2-enamide |
| SMILES | C=C(OC)C(=O)Nc1ccc2nc(-c3ccccc3Br)[nH]c2c1 |
| InChI | InChI=1S/C17H14BrN3O2/c1-10(23-2)17(22)19-11-7-8-14-15(9-11)21-16(20-14)12-5-3-4-6-13(12)18/h3-9H,1H2,2H3,(H,19,22)(H,20,21) |
| InChIKey | IBDJTRSNBRKVQA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|