About 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline
3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline (PubChem CID 174279579) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline |
| PubChem CID | 174279579 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline |
| SMILES | C=C1NC2=C(C=C1C)CCC(C)=C2 |
| InChI | InChI=1S/C12H15N/c1-8-4-5-11-7-9(2)10(3)13-12(11)6-8/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | UBURCLLPDLVXKS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline?
The IUPAC name of 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline (CID 174279579) is 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline.
What is the SMILES notation for 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline?
The canonical SMILES for 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline is C=C1NC2=C(C=C1C)CCC(C)=C2.
What is the InChIKey of 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline?
The InChIKey is UBURCLLPDLVXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-8-4-5-11-7-9(2)10(3)13-12(11)6-8/h6-7,13H,3-5H2,1-2H3.
What are the key properties of 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline?
3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline has a molecular weight of 173.26 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-2-methylidene-5,6-dihydro-1H-quinoline is sourced from PubChem (CID 174279579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).