About 2-ethylsulfonyl-1,3-benzothiazole
2-ethylsulfonyl-1,3-benzothiazole (PubChem CID 17428) has the molecular formula C9H9NO2S2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-ethylsulfonyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-ethylsulfonyl-1,3-benzothiazole |
| PubChem CID | 17428 |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 2-ethylsulfonyl-1,3-benzothiazole |
| SMILES | CCS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9NO2S2/c1-2-14(11,12)9-10-7-5-3-4-6-8(7)13-9/h3-6H,2H2,1H3 |
| InChIKey | ZYGPCLHWVYJMPA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylsulfonyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonyl-1,3-benzothiazole?
The IUPAC name of 2-ethylsulfonyl-1,3-benzothiazole (CID 17428) is 2-ethylsulfonyl-1,3-benzothiazole.
What is the SMILES notation for 2-ethylsulfonyl-1,3-benzothiazole?
The canonical SMILES for 2-ethylsulfonyl-1,3-benzothiazole is CCS(=O)(=O)c1nc2ccccc2s1.
What is the InChIKey of 2-ethylsulfonyl-1,3-benzothiazole?
The InChIKey is ZYGPCLHWVYJMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S2/c1-2-14(11,12)9-10-7-5-3-4-6-8(7)13-9/h3-6H,2H2,1H3.
What are the key properties of 2-ethylsulfonyl-1,3-benzothiazole?
2-ethylsulfonyl-1,3-benzothiazole has a molecular weight of 227.31 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonyl-1,3-benzothiazole is sourced from PubChem (CID 17428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).