About 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol
2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol (PubChem CID 174280168) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol.
Molecular Properties
| Compound Name | 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol |
| PubChem CID | 174280168 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol |
| SMILES | OCC=c1ccc(CS)cc1=CCO |
| InChI | InChI=1S/C11H14O2S/c12-5-3-10-2-1-9(8-14)7-11(10)4-6-13/h1-4,7,12-14H,5-6,8H2 |
| InChIKey | VEQJQEAQLVJGMV-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol?
The IUPAC name of 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol (CID 174280168) is 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol.
What is the SMILES notation for 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol?
The canonical SMILES for 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol is OCC=c1ccc(CS)cc1=CCO.
What is the InChIKey of 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol?
The InChIKey is VEQJQEAQLVJGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c12-5-3-10-2-1-9(8-14)7-11(10)4-6-13/h1-4,7,12-14H,5-6,8H2.
What are the key properties of 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol?
2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol has a molecular weight of 210.30 g/mol, XLogP of -0.34, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(2-hydroxyethylidene)-4-(sulfanylmethyl)cyclohexa-2,4-dien-1-ylidene]ethanol is sourced from PubChem (CID 174280168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).