About N-silylpropan-2-amine;titanium(2+);dichloride
N-silylpropan-2-amine;titanium(2+);dichloride (PubChem CID 174280803) has the molecular formula C3H11Cl2NSiTi
and a molecular weight of 207.99 g/mol. Its IUPAC name is N-silylpropan-2-amine;titanium(2+);dichloride.
Molecular Properties
| Compound Name | N-silylpropan-2-amine;titanium(2+);dichloride |
| PubChem CID | 174280803 |
| Molecular Formula | C3H11Cl2NSiTi |
| Molecular Weight | 207.99 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | N-silylpropan-2-amine;titanium(2+);dichloride |
| SMILES | CC(C)N[SiH3].[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C3H11NSi.2ClH.Ti/c1-3(2)4-5;;;/h3-4H,1-2,5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | QMNWXZOJRLEKCK-UHFFFAOYSA-L |
| XLogP | -6.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.99 |
| LogP ≤ 5 | -6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-silylpropan-2-amine;titanium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-silylpropan-2-amine;titanium(2+);dichloride?
The IUPAC name of N-silylpropan-2-amine;titanium(2+);dichloride (CID 174280803) is N-silylpropan-2-amine;titanium(2+);dichloride.
What is the SMILES notation for N-silylpropan-2-amine;titanium(2+);dichloride?
The canonical SMILES for N-silylpropan-2-amine;titanium(2+);dichloride is CC(C)N[SiH3].[Cl-].[Cl-].[Ti+2].
What is the InChIKey of N-silylpropan-2-amine;titanium(2+);dichloride?
The InChIKey is QMNWXZOJRLEKCK-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H11NSi.2ClH.Ti/c1-3(2)4-5;;;/h3-4H,1-2,5H3;2*1H;/q;;;+2/p-2.
What are the key properties of N-silylpropan-2-amine;titanium(2+);dichloride?
N-silylpropan-2-amine;titanium(2+);dichloride has a molecular weight of 207.99 g/mol, XLogP of -6.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-silylpropan-2-amine;titanium(2+);dichloride is sourced from PubChem (CID 174280803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).