C13H30N2O3Si — CID 174281592
2-[(1,1,2-trimethoxysilinan-2-yl)methyl]butane-1,4-diamine (PubChem CID 174281592) has the molecular formula C13H30N2O3Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 2-[(1,1,2-trimethoxysilinan-2-yl)methyl]butane-1,4-diamine.
| Compound Name | 2-[(1,1,2-trimethoxysilinan-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 174281592 |
| Molecular Formula | C13H30N2O3Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-[(1,1,2-trimethoxysilinan-2-yl)methyl]butane-1,4-diamine |
| SMILES | COC1(CC(CN)CCN)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C13H30N2O3Si/c1-16-13(10-12(11-15)6-8-14)7-4-5-9-19(13,17-2)18-3/h12H,4-11,14-15H2,1-3H3 |
| InChIKey | ZRVNQIJNXZYVRN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|