C22H21N3OS — CID 17428236
2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(1H-indol-3-yl)ethanone (PubChem CID 17428236) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 17428236 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(CN1CCCC(c2nc3ccccc3s2)C1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H21N3OS/c26-20(17-12-23-18-8-2-1-7-16(17)18)14-25-11-5-6-15(13-25)22-24-19-9-3-4-10-21(19)27-22/h1-4,7-10,12,15,23H,5-6,11,13-14H2 |
| InChIKey | JSSINBPDZPKWFY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |