About 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole
3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole (PubChem CID 174282605) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole |
| PubChem CID | 174282605 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole |
| SMILES | CC/C=C\C1=C(CC)CNC1COC |
| InChI | InChI=1S/C12H21NO/c1-4-6-7-11-10(5-2)8-13-12(11)9-14-3/h6-7,12-13H,4-5,8-9H2,1-3H3/b7-6- |
| InChIKey | PBWGHYASFFCETR-SREVYHEPSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole?
The IUPAC name of 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole (CID 174282605) is 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole is CC/C=C\C1=C(CC)CNC1COC.
What is the InChIKey of 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole?
The InChIKey is PBWGHYASFFCETR-SREVYHEPSA-N. The full InChI is InChI=1S/C12H21NO/c1-4-6-7-11-10(5-2)8-13-12(11)9-14-3/h6-7,12-13H,4-5,8-9H2,1-3H3/b7-6-.
What are the key properties of 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole?
3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole has a molecular weight of 195.31 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-1-enyl]-4-ethyl-2-(methoxymethyl)-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 174282605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).