C9H14Cl3NO5P2S2 — CID 174282871
(diethyl-λ4-sulfanylidene)-dihydroxyphosphinothioyloxy-hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane (PubChem CID 174282871) has the molecular formula C9H14Cl3NO5P2S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is (diethyl-λ4-sulfanylidene)-dihydroxyphosphinothioyloxy-hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane.
| Compound Name | (diethyl-λ4-sulfanylidene)-dihydroxyphosphinothioyloxy-hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane |
|---|---|
| PubChem CID | 174282871 |
| Molecular Formula | C9H14Cl3NO5P2S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 446.89 |
| IUPAC Name | (diethyl-λ4-sulfanylidene)-dihydroxyphosphinothioyloxy-hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane |
| SMILES | CCS(CC)=P(O)(Oc1nc(Cl)c(Cl)cc1Cl)OP(O)(O)=S |
| InChI | InChI=1S/C9H14Cl3NO5P2S2/c1-3-22(4-2)20(16,18-19(14,15)21)17-9-7(11)5-6(10)8(12)13-9/h5,16H,3-4H2,1-2H3,(H2,14,15,21) |
| InChIKey | NQDYWDZCIUBHIF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|