C24H22Cl2N4O3 — CID 174284212
N-[[5-[5-(2,4-dichlorophenyl)-1-methylimidazol-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 174284212) has the molecular formula C24H22Cl2N4O3 and a molecular weight of 485.37 g/mol. Its IUPAC name is N-[[5-[5-(2,4-dichlorophenyl)-1-methylimidazol-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[[5-[5-(2,4-dichlorophenyl)-1-methylimidazol-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 174284212 |
| Molecular Formula | C24H22Cl2N4O3 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[[5-[5-(2,4-dichlorophenyl)-1-methylimidazol-4-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | Cc1ccc(-c2ncn(C)c2-c2ccc(Cl)cc2Cl)cc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H22Cl2N4O3/c1-14-3-4-15(9-16(14)11-30(13-31)20-7-8-21(32)28-24(20)33)22-23(29(2)12-27-22)18-6-5-17(25)10-19(18)26/h3-6,9-10,12-13,20H,7-8,11H2,1-2H3,(H,28,32,33) |
| InChIKey | SAAMWZACVGRQGM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|