About 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one
3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one (PubChem CID 174284227) has the molecular formula C14H12O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one.
Molecular Properties
| Compound Name | 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one |
| PubChem CID | 174284227 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one |
| SMILES | O=C1OCc2cc(O)ccc2C2=C1CC(O)C=C2 |
| InChI | InChI=1S/C14H12O4/c15-9-1-3-11-8(5-9)7-18-14(17)13-6-10(16)2-4-12(11)13/h1-5,10,15-16H,6-7H2 |
| InChIKey | DAFRFJVALLNMAR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one?
The IUPAC name of 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one (CID 174284227) is 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one.
What is the SMILES notation for 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one?
The canonical SMILES for 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one is O=C1OCc2cc(O)ccc2C2=C1CC(O)C=C2.
What is the InChIKey of 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one?
The InChIKey is DAFRFJVALLNMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c15-9-1-3-11-8(5-9)7-18-14(17)13-6-10(16)2-4-12(11)13/h1-5,10,15-16H,6-7H2.
What are the key properties of 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one?
3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one has a molecular weight of 244.25 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dihydroxy-8,9-dihydro-5H-benzo[d][2]benzoxepin-7-one is sourced from PubChem (CID 174284227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).