About 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium
5-fluoro-1-methyl-3,4-dihydropyridin-1-ium (PubChem CID 174284531) has the molecular formula C6H9FN+
and a molecular weight of 114.14 g/mol. Its IUPAC name is 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium |
| PubChem CID | 174284531 |
| Molecular Formula | C6H9FN+ |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium |
| SMILES | C[N+]1=CCCC(F)=C1 |
| InChI | InChI=1S/C6H9FN/c1-8-4-2-3-6(7)5-8/h4-5H,2-3H2,1H3/q+1 |
| InChIKey | DBXTZOAVIFWCOW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium?
The IUPAC name of 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium (CID 174284531) is 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium.
What is the SMILES notation for 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium?
The canonical SMILES for 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium is C[N+]1=CCCC(F)=C1.
What is the InChIKey of 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium?
The InChIKey is DBXTZOAVIFWCOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN/c1-8-4-2-3-6(7)5-8/h4-5H,2-3H2,1H3/q+1.
What are the key properties of 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium?
5-fluoro-1-methyl-3,4-dihydropyridin-1-ium has a molecular weight of 114.14 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-methyl-3,4-dihydropyridin-1-ium is sourced from PubChem (CID 174284531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).