About 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine
7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 174284597) has the molecular formula C22H16ClFN4S
and a molecular weight of 422.92 g/mol. Its IUPAC name is 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 174284597 |
| Molecular Formula | C22H16ClFN4S |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | Fc1ccc(-c2nc(CCCc3c[nH]c4ccc(Cl)cc34)c3ncsc3n2)cc1 |
| InChI | InChI=1S/C22H16ClFN4S/c23-15-6-9-18-17(10-15)14(11-25-18)2-1-3-19-20-22(29-12-26-20)28-21(27-19)13-4-7-16(24)8-5-13/h4-12,25H,1-3H2 |
| InChIKey | YIQTVTAQPOGXPL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine (CID 174284597) is 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine is Fc1ccc(-c2nc(CCCc3c[nH]c4ccc(Cl)cc34)c3ncsc3n2)cc1.
What is the InChIKey of 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is YIQTVTAQPOGXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClFN4S/c23-15-6-9-18-17(10-15)14(11-25-18)2-1-3-19-20-22(29-12-26-20)28-21(27-19)13-4-7-16(24)8-5-13/h4-12,25H,1-3H2.
What are the key properties of 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine?
7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 422.92 g/mol, XLogP of 6.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(5-chloro-1H-indol-3-yl)propyl]-5-(4-fluorophenyl)-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 174284597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).