C29H46O4 — CID 174284741
2-[[(3S,8S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoacetic acid (PubChem CID 174284741) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is 2-[[(3S,8S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoacetic acid.
| Compound Name | 2-[[(3S,8S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 174284741 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 2-[[(3S,8S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoacetic acid |
| SMILES | CC(C)CCC[C@@H](C)C1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)C(=O)O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C29H46O4/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(33-27(32)26(30)31)13-15-28(20,4)25(22)14-16-29(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3,(H,30,31)/t19-,21+,22+,23?,24+,25?,28+,29-/m1/s1 |
| InChIKey | XCXDKIUJEGJDJL-MDHFQSHQSA-N |
| XLogP | 7.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|