C20H33N — CID 174285177
(4Z)-N-[(7,7-dimethylcyclohepta-1,5-dien-1-yl)methyl]-N,3,3-trimethylhepta-4,6-dien-1-amine (PubChem CID 174285177) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is (4Z)-N-[(7,7-dimethylcyclohepta-1,5-dien-1-yl)methyl]-N,3,3-trimethylhepta-4,6-dien-1-amine.
| Compound Name | (4Z)-N-[(7,7-dimethylcyclohepta-1,5-dien-1-yl)methyl]-N,3,3-trimethylhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 174285177 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (4Z)-N-[(7,7-dimethylcyclohepta-1,5-dien-1-yl)methyl]-N,3,3-trimethylhepta-4,6-dien-1-amine |
| SMILES | C=C/C=C\C(C)(C)CCN(C)CC1=CCCC=CC1(C)C |
| InChI | InChI=1S/C20H33N/c1-7-8-13-19(2,3)15-16-21(6)17-18-12-10-9-11-14-20(18,4)5/h7-8,11-14H,1,9-10,15-17H2,2-6H3/b13-8- |
| InChIKey | JRQGGRDCBDVZCE-JYRVWZFOSA-N |
| XLogP | 5.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|