About 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine
5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine (PubChem CID 174285327) has the molecular formula C10H20IN
and a molecular weight of 281.18 g/mol. Its IUPAC name is 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine.
Molecular Properties
| Compound Name | 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine |
| PubChem CID | 174285327 |
| Molecular Formula | C10H20IN |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine |
| SMILES | CCC(CI)CC(NC)=C(C)C |
| InChI | InChI=1S/C10H20IN/c1-5-9(7-11)6-10(12-4)8(2)3/h9,12H,5-7H2,1-4H3 |
| InChIKey | HUCGWQHUYYOUGH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine?
The IUPAC name of 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine (CID 174285327) is 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine.
What is the SMILES notation for 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine?
The canonical SMILES for 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine is CCC(CI)CC(NC)=C(C)C.
What is the InChIKey of 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine?
The InChIKey is HUCGWQHUYYOUGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20IN/c1-5-9(7-11)6-10(12-4)8(2)3/h9,12H,5-7H2,1-4H3.
What are the key properties of 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine?
5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine has a molecular weight of 281.18 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(iodomethyl)-N,2-dimethylhept-2-en-3-amine is sourced from PubChem (CID 174285327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).