About 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride
2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride (PubChem CID 174286433) has the molecular formula C7H13Cl2NO2S
and a molecular weight of 246.16 g/mol. Its IUPAC name is 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride |
| PubChem CID | 174286433 |
| Molecular Formula | C7H13Cl2NO2S |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride |
| SMILES | CC(=O)OCCN1C=CSC1.Cl.Cl |
| InChI | InChI=1S/C7H11NO2S.2ClH/c1-7(9)10-4-2-8-3-5-11-6-8;;/h3,5H,2,4,6H2,1H3;2*1H |
| InChIKey | XFHYTLSSRIKJNI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride?
The IUPAC name of 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride (CID 174286433) is 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride.
What is the SMILES notation for 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride?
The canonical SMILES for 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride is CC(=O)OCCN1C=CSC1.Cl.Cl.
What is the InChIKey of 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride?
The InChIKey is XFHYTLSSRIKJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S.2ClH/c1-7(9)10-4-2-8-3-5-11-6-8;;/h3,5H,2,4,6H2,1H3;2*1H.
What are the key properties of 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride?
2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride has a molecular weight of 246.16 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-1,3-thiazol-3-yl)ethyl acetate;dihydrochloride is sourced from PubChem (CID 174286433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).