N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride

C6H9FN2 — CID 174286703

IUPACN'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride
SMILESC=C(C)C=N/C(F)=N/C
InChIInChI=1S/C6H9FN2/c1-5(2)4-9-6(7)8-3/h4H,1H2,2-3H3/b8-6+,9-4?
InChIKeyHJKNWEFAIVROGJ-OGEONMARSA-N
MW128.15 g/mol
LogP1.59
Rot. Bonds1

About N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride

N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride (PubChem CID 174286703) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride.

Molecular Properties

Compound NameN'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride
PubChem CID174286703
Molecular FormulaC6H9FN2
Molecular Weight128.15 g/mol
Exact Mass128.07
IUPAC NameN'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride
SMILESC=C(C)C=N/C(F)=N/C
InChIInChI=1S/C6H9FN2/c1-5(2)4-9-6(7)8-3/h4H,1H2,2-3H3/b8-6+,9-4?
InChIKeyHJKNWEFAIVROGJ-OGEONMARSA-N
XLogP1.59
TPSA24.72 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.15
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride?
The IUPAC name of N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride (CID 174286703) is N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride.
What is the SMILES notation for N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride?
The canonical SMILES for N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride is C=C(C)C=N/C(F)=N/C.
What is the InChIKey of N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride?
The InChIKey is HJKNWEFAIVROGJ-OGEONMARSA-N. The full InChI is InChI=1S/C6H9FN2/c1-5(2)4-9-6(7)8-3/h4H,1H2,2-3H3/b8-6+,9-4?.
What are the key properties of N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride?
N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride has a molecular weight of 128.15 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-(2-methylprop-2-enylidene)carbamimidoyl fluoride is sourced from PubChem (CID 174286703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).