C9H17N5O2S — CID 174286810
1-methyl-4-(piperazin-1-ylmethyl)pyrazole-5-sulfonamide (PubChem CID 174286810) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-methyl-4-(piperazin-1-ylmethyl)pyrazole-5-sulfonamide.
| Compound Name | 1-methyl-4-(piperazin-1-ylmethyl)pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 174286810 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-methyl-4-(piperazin-1-ylmethyl)pyrazole-5-sulfonamide |
| SMILES | Cn1ncc(CN2CCNCC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H17N5O2S/c1-13-9(17(10,15)16)8(6-12-13)7-14-4-2-11-3-5-14/h6,11H,2-5,7H2,1H3,(H2,10,15,16) |
| InChIKey | RIWIIBZHKJFVNH-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |