About 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine
1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine (PubChem CID 174286889) has the molecular formula C10H16F2N4
and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine.
Molecular Properties
| Compound Name | 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine |
| PubChem CID | 174286889 |
| Molecular Formula | C10H16F2N4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine |
| SMILES | FC(F)Cn1nccc1CN1CCNCC1 |
| InChI | InChI=1S/C10H16F2N4/c11-10(12)8-16-9(1-2-14-16)7-15-5-3-13-4-6-15/h1-2,10,13H,3-8H2 |
| InChIKey | DLNHAZPFZINOOJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine?
The IUPAC name of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine (CID 174286889) is 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine.
What is the SMILES notation for 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine?
The canonical SMILES for 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine is FC(F)Cn1nccc1CN1CCNCC1.
What is the InChIKey of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine?
The InChIKey is DLNHAZPFZINOOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N4/c11-10(12)8-16-9(1-2-14-16)7-15-5-3-13-4-6-15/h1-2,10,13H,3-8H2.
What are the key properties of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine?
1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine has a molecular weight of 230.26 g/mol, XLogP of 0.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]piperazine is sourced from PubChem (CID 174286889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).