C11H19N — CID 174286987
(3R)-2-[(Z)-but-1-enyl]-3,4-dimethyl-2,3,4,5-tetrahydropyridine (PubChem CID 174286987) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (3R)-2-[(Z)-but-1-enyl]-3,4-dimethyl-2,3,4,5-tetrahydropyridine.
| Compound Name | (3R)-2-[(Z)-but-1-enyl]-3,4-dimethyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 174286987 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (3R)-2-[(Z)-but-1-enyl]-3,4-dimethyl-2,3,4,5-tetrahydropyridine |
| SMILES | CC/C=C\C1N=CCC(C)[C@H]1C |
| InChI | InChI=1S/C11H19N/c1-4-5-6-11-10(3)9(2)7-8-12-11/h5-6,8-11H,4,7H2,1-3H3/b6-5-/t9?,10-,11?/m1/s1 |
| InChIKey | PYEQCFSPBCNNTC-IDKZTGHVSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|