C9H18O2 — CID 174287039
butane-1,4-diol;3-methylbuta-1,2-diene (PubChem CID 174287039) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is butane-1,4-diol;3-methylbuta-1,2-diene.
| Compound Name | butane-1,4-diol;3-methylbuta-1,2-diene |
|---|---|
| PubChem CID | 174287039 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | butane-1,4-diol;3-methylbuta-1,2-diene |
| SMILES | C=C=C(C)C.OCCCCO |
| InChI | InChI=1S/C5H8.C4H10O2/c1-4-5(2)3;5-3-1-2-4-6/h1H2,2-3H3;5-6H,1-4H2 |
| InChIKey | HYUOWWQFZKDJCR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|