About N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine
N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine (PubChem CID 174287463) has the molecular formula C14H26N4
and a molecular weight of 250.39 g/mol. Its IUPAC name is N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine |
| PubChem CID | 174287463 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine |
| SMILES | Cc1nc(NCCCN)c(C(C)C)c(C(C)C)n1 |
| InChI | InChI=1S/C14H26N4/c1-9(2)12-13(10(3)4)17-11(5)18-14(12)16-8-6-7-15/h9-10H,6-8,15H2,1-5H3,(H,16,17,18) |
| InChIKey | ATYVIGBFTWGRAV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine?
The IUPAC name of N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine (CID 174287463) is N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine.
What is the SMILES notation for N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine?
The canonical SMILES for N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine is Cc1nc(NCCCN)c(C(C)C)c(C(C)C)n1.
What is the InChIKey of N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine?
The InChIKey is ATYVIGBFTWGRAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4/c1-9(2)12-13(10(3)4)17-11(5)18-14(12)16-8-6-7-15/h9-10H,6-8,15H2,1-5H3,(H,16,17,18).
What are the key properties of N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine?
N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine has a molecular weight of 250.39 g/mol, XLogP of 2.79, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]propane-1,3-diamine is sourced from PubChem (CID 174287463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).