About 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol
2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol (PubChem CID 174287550) has the molecular formula C13H23N3S
and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol.
Molecular Properties
| Compound Name | 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol |
| PubChem CID | 174287550 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol |
| SMILES | Cc1nc(NCCS)c(C(C)C)c(C(C)C)n1 |
| InChI | InChI=1S/C13H23N3S/c1-8(2)11-12(9(3)4)15-10(5)16-13(11)14-6-7-17/h8-9,17H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | RZVLCYUVWOHBGI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol?
The IUPAC name of 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol (CID 174287550) is 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol.
What is the SMILES notation for 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol?
The canonical SMILES for 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol is Cc1nc(NCCS)c(C(C)C)c(C(C)C)n1.
What is the InChIKey of 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol?
The InChIKey is RZVLCYUVWOHBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3S/c1-8(2)11-12(9(3)4)15-10(5)16-13(11)14-6-7-17/h8-9,17H,6-7H2,1-5H3,(H,14,15,16).
What are the key properties of 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol?
2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol has a molecular weight of 253.41 g/mol, XLogP of 3.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-methyl-5,6-di(propan-2-yl)pyrimidin-4-yl]amino]ethanethiol is sourced from PubChem (CID 174287550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).