About magnesium;1,3-dimethylbenzene-5-ide;ethane
magnesium;1,3-dimethylbenzene-5-ide;ethane (PubChem CID 174288802) has the molecular formula C10H14Mg
and a molecular weight of 158.53 g/mol. Its IUPAC name is magnesium;1,3-dimethylbenzene-5-ide;ethane.
Molecular Properties
| Compound Name | magnesium;1,3-dimethylbenzene-5-ide;ethane |
| PubChem CID | 174288802 |
| Molecular Formula | C10H14Mg |
| Molecular Weight | 158.53 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | magnesium;1,3-dimethylbenzene-5-ide;ethane |
| SMILES | Cc1c[c-]cc(C)c1.[CH2-]C.[Mg+2] |
| InChI | InChI=1S/C8H9.C2H5.Mg/c1-7-4-3-5-8(2)6-7;1-2;/h4-6H,1-2H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | ZMLIDTBUHCMUNH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,3-dimethylbenzene-5-ide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,3-dimethylbenzene-5-ide;ethane?
The IUPAC name of magnesium;1,3-dimethylbenzene-5-ide;ethane (CID 174288802) is magnesium;1,3-dimethylbenzene-5-ide;ethane.
What is the SMILES notation for magnesium;1,3-dimethylbenzene-5-ide;ethane?
The canonical SMILES for magnesium;1,3-dimethylbenzene-5-ide;ethane is Cc1c[c-]cc(C)c1.[CH2-]C.[Mg+2].
What is the InChIKey of magnesium;1,3-dimethylbenzene-5-ide;ethane?
The InChIKey is ZMLIDTBUHCMUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9.C2H5.Mg/c1-7-4-3-5-8(2)6-7;1-2;/h4-6H,1-2H3;1H2,2H3;/q2*-1;+2.
What are the key properties of magnesium;1,3-dimethylbenzene-5-ide;ethane?
magnesium;1,3-dimethylbenzene-5-ide;ethane has a molecular weight of 158.53 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,3-dimethylbenzene-5-ide;ethane is sourced from PubChem (CID 174288802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).